C11H10FNO2S — CID 115073043
2-amino-2-(6-fluoro-2-methyl-1-benzothiophen-3-yl)acetic acid (PubChem CID 115073043) has the molecular formula C11H10FNO2S and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-amino-2-(6-fluoro-2-methyl-1-benzothiophen-3-yl)acetic acid.
| Compound Name | 2-amino-2-(6-fluoro-2-methyl-1-benzothiophen-3-yl)acetic acid |
|---|---|
| PubChem CID | 115073043 |
| Molecular Formula | C11H10FNO2S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-amino-2-(6-fluoro-2-methyl-1-benzothiophen-3-yl)acetic acid |
| SMILES | Cc1sc2cc(F)ccc2c1C(N)C(=O)O |
| InChI | InChI=1S/C11H10FNO2S/c1-5-9(10(13)11(14)15)7-3-2-6(12)4-8(7)16-5/h2-4,10H,13H2,1H3,(H,14,15) |
| InChIKey | NKRXOFRYKSGQGL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |