2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid

C12H12O3S — CID 117344982

IUPAC2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid
SMILESCc1sc2cc(C(O)C(=O)O)ccc2c1C
InChIInChI=1S/C12H12O3S/c1-6-7(2)16-10-5-8(3-4-9(6)10)11(13)12(14)15/h3-5,11,13H,1-2H3,(H,14,15)
InChIKeyLBADNFWUYBUMOZ-UHFFFAOYSA-N
MW236.29 g/mol
LogP2.64
Rot. Bonds2

About 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid

2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid (PubChem CID 117344982) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid
PubChem CID117344982
Molecular FormulaC12H12O3S
Molecular Weight236.29 g/mol
Exact Mass236.05
IUPAC Name2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid
SMILESCc1sc2cc(C(O)C(=O)O)ccc2c1C
InChIInChI=1S/C12H12O3S/c1-6-7(2)16-10-5-8(3-4-9(6)10)11(13)12(14)15/h3-5,11,13H,1-2H3,(H,14,15)
InChIKeyLBADNFWUYBUMOZ-UHFFFAOYSA-N
XLogP2.64
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.29
LogP ≤ 52.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid?
The IUPAC name of 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid (CID 117344982) is 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid.
What is the SMILES notation for 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid?
The canonical SMILES for 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid is Cc1sc2cc(C(O)C(=O)O)ccc2c1C.
What is the InChIKey of 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid?
The InChIKey is LBADNFWUYBUMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3S/c1-6-7(2)16-10-5-8(3-4-9(6)10)11(13)12(14)15/h3-5,11,13H,1-2H3,(H,14,15).
What are the key properties of 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid?
2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid has a molecular weight of 236.29 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid is sourced from PubChem (CID 117344982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).