C12H12O3S — CID 117344982
2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid (PubChem CID 117344982) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid.
| Compound Name | 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117344982 |
| Molecular Formula | C12H12O3S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-(2,3-dimethyl-1-benzothiophen-6-yl)-2-hydroxyacetic acid |
| SMILES | Cc1sc2cc(C(O)C(=O)O)ccc2c1C |
| InChI | InChI=1S/C12H12O3S/c1-6-7(2)16-10-5-8(3-4-9(6)10)11(13)12(14)15/h3-5,11,13H,1-2H3,(H,14,15) |
| InChIKey | LBADNFWUYBUMOZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |