C11H9F3N2O2 — CID 115073427
2-amino-2-[6-(trifluoromethyl)-1H-indol-3-yl]acetic acid (PubChem CID 115073427) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is 2-amino-2-[6-(trifluoromethyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-amino-2-[6-(trifluoromethyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 115073427 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-amino-2-[6-(trifluoromethyl)-1H-indol-3-yl]acetic acid |
| SMILES | NC(C(=O)O)c1c[nH]c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C11H9F3N2O2/c12-11(13,14)5-1-2-6-7(9(15)10(17)18)4-16-8(6)3-5/h1-4,9,16H,15H2,(H,17,18) |
| InChIKey | HYCZONFDCSPZGN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |