C14H20N2O — CID 115075947
5-(1,3-dimethylpyrrolidin-3-yl)oxy-2,3-dihydro-1H-isoindole (PubChem CID 115075947) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-(1,3-dimethylpyrrolidin-3-yl)oxy-2,3-dihydro-1H-isoindole.
| Compound Name | 5-(1,3-dimethylpyrrolidin-3-yl)oxy-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 115075947 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 5-(1,3-dimethylpyrrolidin-3-yl)oxy-2,3-dihydro-1H-isoindole |
| SMILES | CN1CCC(C)(Oc2ccc3c(c2)CNC3)C1 |
| InChI | InChI=1S/C14H20N2O/c1-14(5-6-16(2)10-14)17-13-4-3-11-8-15-9-12(11)7-13/h3-4,7,15H,5-6,8-10H2,1-2H3 |
| InChIKey | QOLPUDRTAWXVCL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |