About 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole
5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole (PubChem CID 115076103) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole |
| PubChem CID | 115076103 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole |
| SMILES | CN1CCCC(C)(Oc2ccc3c(c2)CNC3)C1 |
| InChI | InChI=1S/C15H22N2O/c1-15(6-3-7-17(2)11-15)18-14-5-4-12-9-16-10-13(12)8-14/h4-5,8,16H,3,6-7,9-11H2,1-2H3 |
| InChIKey | BLSQEKYZRAYTIJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole?
The IUPAC name of 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole (CID 115076103) is 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole?
The canonical SMILES for 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole is CN1CCCC(C)(Oc2ccc3c(c2)CNC3)C1.
What is the InChIKey of 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole?
The InChIKey is BLSQEKYZRAYTIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O/c1-15(6-3-7-17(2)11-15)18-14-5-4-12-9-16-10-13(12)8-14/h4-5,8,16H,3,6-7,9-11H2,1-2H3.
What are the key properties of 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole?
5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole has a molecular weight of 246.35 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dimethylpiperidin-3-yl)oxy-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 115076103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).