2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid

C16H17NO6S — CID 11508577

IUPAC2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid
SMILESCC(C)(C)NS(=O)(=O)c1c(C(=O)O)cc2ccccc2c1C(=O)O
InChIInChI=1S/C16H17NO6S/c1-16(2,3)17-24(22,23)13-11(14(18)19)8-9-6-4-5-7-10(9)12(13)15(20)21/h4-8,17H,1-3H3,(H,18,19)(H,20,21)
InChIKeyUYCWWUQIBOJTDK-UHFFFAOYSA-N
MW351.38 g/mol
LogP2.31
Rot. Bonds4

About 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid

2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid (PubChem CID 11508577) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid
PubChem CID11508577
Molecular FormulaC16H17NO6S
Molecular Weight351.38 g/mol
Exact Mass351.08
IUPAC Name2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid
SMILESCC(C)(C)NS(=O)(=O)c1c(C(=O)O)cc2ccccc2c1C(=O)O
InChIInChI=1S/C16H17NO6S/c1-16(2,3)17-24(22,23)13-11(14(18)19)8-9-6-4-5-7-10(9)12(13)15(20)21/h4-8,17H,1-3H3,(H,18,19)(H,20,21)
InChIKeyUYCWWUQIBOJTDK-UHFFFAOYSA-N
XLogP2.31
TPSA120.77 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500351.38
LogP ≤ 52.31
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid?
The IUPAC name of 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid (CID 11508577) is 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid?
The canonical SMILES for 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid is CC(C)(C)NS(=O)(=O)c1c(C(=O)O)cc2ccccc2c1C(=O)O.
What is the InChIKey of 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid?
The InChIKey is UYCWWUQIBOJTDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO6S/c1-16(2,3)17-24(22,23)13-11(14(18)19)8-9-6-4-5-7-10(9)12(13)15(20)21/h4-8,17H,1-3H3,(H,18,19)(H,20,21).
What are the key properties of 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid?
2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid has a molecular weight of 351.38 g/mol, XLogP of 2.31, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid is sourced from PubChem (CID 11508577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).