C16H17NO6S — CID 11508577
2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid (PubChem CID 11508577) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid.
| Compound Name | 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 11508577 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-(tert-butylsulfamoyl)naphthalene-1,3-dicarboxylic acid |
| SMILES | CC(C)(C)NS(=O)(=O)c1c(C(=O)O)cc2ccccc2c1C(=O)O |
| InChI | InChI=1S/C16H17NO6S/c1-16(2,3)17-24(22,23)13-11(14(18)19)8-9-6-4-5-7-10(9)12(13)15(20)21/h4-8,17H,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | UYCWWUQIBOJTDK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |