C10H10ClNO3 — CID 115086467
1-[2-(5-chlorofuran-2-yl)-1,3-oxazol-5-yl]propan-2-ol (PubChem CID 115086467) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is 1-[2-(5-chlorofuran-2-yl)-1,3-oxazol-5-yl]propan-2-ol.
| Compound Name | 1-[2-(5-chlorofuran-2-yl)-1,3-oxazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 115086467 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 1-[2-(5-chlorofuran-2-yl)-1,3-oxazol-5-yl]propan-2-ol |
| SMILES | CC(O)Cc1cnc(-c2ccc(Cl)o2)o1 |
| InChI | InChI=1S/C10H10ClNO3/c1-6(13)4-7-5-12-10(14-7)8-2-3-9(11)15-8/h2-3,5-6,13H,4H2,1H3 |
| InChIKey | NFIOXLDQZLVSLS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |