C12H12ClNO2 — CID 115087110
1-[2-(3-chlorophenyl)-1,3-oxazol-5-yl]propan-2-ol (PubChem CID 115087110) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-1,3-oxazol-5-yl]propan-2-ol.
| Compound Name | 1-[2-(3-chlorophenyl)-1,3-oxazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 115087110 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-1,3-oxazol-5-yl]propan-2-ol |
| SMILES | CC(O)Cc1cnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C12H12ClNO2/c1-8(15)5-11-7-14-12(16-11)9-3-2-4-10(13)6-9/h2-4,6-8,15H,5H2,1H3 |
| InChIKey | BCHWIDJWVDVLKA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |