C11H15NO2S — CID 115091091
2-[2-(oxan-3-ylmethyl)-1,3-thiazol-5-yl]acetaldehyde (PubChem CID 115091091) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-[2-(oxan-3-ylmethyl)-1,3-thiazol-5-yl]acetaldehyde.
| Compound Name | 2-[2-(oxan-3-ylmethyl)-1,3-thiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115091091 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-[2-(oxan-3-ylmethyl)-1,3-thiazol-5-yl]acetaldehyde |
| SMILES | O=CCc1cnc(CC2CCCOC2)s1 |
| InChI | InChI=1S/C11H15NO2S/c13-4-3-10-7-12-11(15-10)6-9-2-1-5-14-8-9/h4,7,9H,1-3,5-6,8H2 |
| InChIKey | UCKHQTWGVXRSEX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|