C10H15NO3 — CID 115093628
[5-(oxan-3-ylmethyl)-1,2-oxazol-4-yl]methanol (PubChem CID 115093628) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is [5-(oxan-3-ylmethyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [5-(oxan-3-ylmethyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 115093628 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | [5-(oxan-3-ylmethyl)-1,2-oxazol-4-yl]methanol |
| SMILES | OCc1cnoc1CC1CCCOC1 |
| InChI | InChI=1S/C10H15NO3/c12-6-9-5-11-14-10(9)4-8-2-1-3-13-7-8/h5,8,12H,1-4,6-7H2 |
| InChIKey | UMICBIDMYBYPQN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |