C11H8ClNOS — CID 115091914
2-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]acetaldehyde (PubChem CID 115091914) has the molecular formula C11H8ClNOS and a molecular weight of 237.71 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]acetaldehyde.
| Compound Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115091914 |
| Molecular Formula | C11H8ClNOS |
| Molecular Weight | 237.71 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]acetaldehyde |
| SMILES | O=CCc1cnc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C11H8ClNOS/c12-9-3-1-8(2-4-9)11-13-7-10(15-11)5-6-14/h1-4,6-7H,5H2 |
| InChIKey | JPEIPNPRRZKIOX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|