About 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane
7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane (PubChem CID 167926234) has the molecular formula C16H17ClN2OS
and a molecular weight of 320.84 g/mol. Its IUPAC name is 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane.
Molecular Properties
| Compound Name | 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane |
| PubChem CID | 167926234 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane |
| SMILES | Clc1ccc(-c2ncc(CN3CCC4(COC4)C3)s2)cc1 |
| InChI | InChI=1S/C16H17ClN2OS/c17-13-3-1-12(2-4-13)15-18-7-14(21-15)8-19-6-5-16(9-19)10-20-11-16/h1-4,7H,5-6,8-11H2 |
| InChIKey | SLZAXRWOFHVZKA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane?
The IUPAC name of 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane (CID 167926234) is 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane.
What is the SMILES notation for 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane?
The canonical SMILES for 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane is Clc1ccc(-c2ncc(CN3CCC4(COC4)C3)s2)cc1.
What is the InChIKey of 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane?
The InChIKey is SLZAXRWOFHVZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2OS/c17-13-3-1-12(2-4-13)15-18-7-14(21-15)8-19-6-5-16(9-19)10-20-11-16/h1-4,7H,5-6,8-11H2.
What are the key properties of 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane?
7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane has a molecular weight of 320.84 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-oxa-7-azaspiro[3.4]octane is sourced from PubChem (CID 167926234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).