C10H14N2O2 — CID 115093357
5-(1-methylpiperidin-4-yl)-1,2-oxazole-4-carbaldehyde (PubChem CID 115093357) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-(1-methylpiperidin-4-yl)-1,2-oxazole-4-carbaldehyde.
| Compound Name | 5-(1-methylpiperidin-4-yl)-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 115093357 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 5-(1-methylpiperidin-4-yl)-1,2-oxazole-4-carbaldehyde |
| SMILES | CN1CCC(c2oncc2C=O)CC1 |
| InChI | InChI=1S/C10H14N2O2/c1-12-4-2-8(3-5-12)10-9(7-13)6-11-14-10/h6-8H,2-5H2,1H3 |
| InChIKey | DNARZAACIPRNNK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|