C8H10N2O2 — CID 115093494
5-pyrrolidin-2-yl-1,2-oxazole-4-carbaldehyde (PubChem CID 115093494) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-pyrrolidin-2-yl-1,2-oxazole-4-carbaldehyde.
| Compound Name | 5-pyrrolidin-2-yl-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 115093494 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 5-pyrrolidin-2-yl-1,2-oxazole-4-carbaldehyde |
| SMILES | O=Cc1cnoc1C1CCCN1 |
| InChI | InChI=1S/C8H10N2O2/c11-5-6-4-10-12-8(6)7-2-1-3-9-7/h4-5,7,9H,1-3H2 |
| InChIKey | LTLPJAJPIVECII-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|