C7H11N3O — CID 105429881
4-pyrrolidin-2-yl-1,2-oxazol-5-amine (PubChem CID 105429881) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 4-pyrrolidin-2-yl-1,2-oxazol-5-amine.
| Compound Name | 4-pyrrolidin-2-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 105429881 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 4-pyrrolidin-2-yl-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1C1CCCN1 |
| InChI | InChI=1S/C7H11N3O/c8-7-5(4-10-11-7)6-2-1-3-9-6/h4,6,9H,1-3,8H2 |
| InChIKey | ZOFLSAOODQNOSZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |