C8H13N3O — CID 115093519
5-piperidin-2-yl-1,2-oxazol-4-amine (PubChem CID 115093519) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 5-piperidin-2-yl-1,2-oxazol-4-amine.
| Compound Name | 5-piperidin-2-yl-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 115093519 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-piperidin-2-yl-1,2-oxazol-4-amine |
| SMILES | Nc1cnoc1C1CCCCN1 |
| InChI | InChI=1S/C8H13N3O/c9-6-5-11-12-8(6)7-3-1-2-4-10-7/h5,7,10H,1-4,9H2 |
| InChIKey | HLBAZMMJKPBBSF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |