C12H18N2O2 — CID 115094179
5-[(1-ethylpiperidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde (PubChem CID 115094179) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-[(1-ethylpiperidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde.
| Compound Name | 5-[(1-ethylpiperidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 115094179 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 5-[(1-ethylpiperidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde |
| SMILES | CCN1CCCCC1Cc1cc(C=O)no1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-14-6-4-3-5-11(14)8-12-7-10(9-15)13-16-12/h7,9,11H,2-6,8H2,1H3 |
| InChIKey | UPPGPMHPWCZICS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|