C10H10BrNO3S — CID 115095203
7-bromo-3,3-dimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-2-one (PubChem CID 115095203) has the molecular formula C10H10BrNO3S and a molecular weight of 304.17 g/mol. Its IUPAC name is 7-bromo-3,3-dimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-2-one.
| Compound Name | 7-bromo-3,3-dimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-2-one |
|---|---|
| PubChem CID | 115095203 |
| Molecular Formula | C10H10BrNO3S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 7-bromo-3,3-dimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-2-one |
| SMILES | CC1(C)Nc2ccc(Br)cc2S(=O)(=O)C1=O |
| InChI | InChI=1S/C10H10BrNO3S/c1-10(2)9(13)16(14,15)8-5-6(11)3-4-7(8)12-10/h3-5,12H,1-2H3 |
| InChIKey | CHMHURLKROZZMG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|