C8H10BrN3O3S — CID 135845295
7-bromo-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine;hydrate (PubChem CID 135845295) has the molecular formula C8H10BrN3O3S and a molecular weight of 308.16 g/mol. Its IUPAC name is 7-bromo-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine;hydrate.
| Compound Name | 7-bromo-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine;hydrate |
|---|---|
| PubChem CID | 135845295 |
| Molecular Formula | C8H10BrN3O3S |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 7-bromo-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine;hydrate |
| SMILES | C/N=C1\Nc2ccc(Br)cc2S(=O)(=O)N1.O |
| InChI | InChI=1S/C8H8BrN3O2S.H2O/c1-10-8-11-6-3-2-5(9)4-7(6)15(13,14)12-8;/h2-4H,1H3,(H2,10,11,12);1H2 |
| InChIKey | BAXAFUNONNTQTN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|