C11H12N4O2S — CID 135404306
1,1-dioxo-3-propan-2-ylimino-4H-1λ6,2,4-benzothiadiazine-7-carbonitrile (PubChem CID 135404306) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 1,1-dioxo-3-propan-2-ylimino-4H-1λ6,2,4-benzothiadiazine-7-carbonitrile.
| Compound Name | 1,1-dioxo-3-propan-2-ylimino-4H-1λ6,2,4-benzothiadiazine-7-carbonitrile |
|---|---|
| PubChem CID | 135404306 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1,1-dioxo-3-propan-2-ylimino-4H-1λ6,2,4-benzothiadiazine-7-carbonitrile |
| SMILES | CC(C)/N=C1\Nc2ccc(C#N)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C11H12N4O2S/c1-7(2)13-11-14-9-4-3-8(6-12)5-10(9)18(16,17)15-11/h3-5,7H,1-2H3,(H2,13,14,15) |
| InChIKey | REMALMSZBHCKEC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|