C12H14ClN3O3S — CID 171526925
[1-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]cyclobutyl]methanol (PubChem CID 171526925) has the molecular formula C12H14ClN3O3S and a molecular weight of 315.78 g/mol. Its IUPAC name is [1-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]cyclobutyl]methanol.
| Compound Name | [1-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 171526925 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | [1-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]cyclobutyl]methanol |
| SMILES | O=S1(=O)N/C(=N/C2(CO)CCC2)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H14ClN3O3S/c13-8-2-3-9-10(6-8)20(18,19)16-11(14-9)15-12(7-17)4-1-5-12/h2-3,6,17H,1,4-5,7H2,(H2,14,15,16) |
| InChIKey | XISJEIMIKYSERV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|