C10H12ClN3O3S — CID 135845265
2-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]propan-1-ol (PubChem CID 135845265) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is 2-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]propan-1-ol.
| Compound Name | 2-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]propan-1-ol |
|---|---|
| PubChem CID | 135845265 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[(7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-ylidene)amino]propan-1-ol |
| SMILES | CC(CO)/N=C1\Nc2ccc(Cl)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C10H12ClN3O3S/c1-6(5-15)12-10-13-8-3-2-7(11)4-9(8)18(16,17)14-10/h2-4,6,15H,5H2,1H3,(H2,12,13,14) |
| InChIKey | NCZXGDLQSKSRKV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|