C9H10N2O2S2 — CID 82213862
7-ethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-thione (PubChem CID 82213862) has the molecular formula C9H10N2O2S2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 7-ethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-thione.
| Compound Name | 7-ethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-thione |
|---|---|
| PubChem CID | 82213862 |
| Molecular Formula | C9H10N2O2S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 7-ethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-thione |
| SMILES | CCc1ccc2c(c1)S(=O)(=O)NC(=S)N2 |
| InChI | InChI=1S/C9H10N2O2S2/c1-2-6-3-4-7-8(5-6)15(12,13)11-9(14)10-7/h3-5H,2H2,1H3,(H2,10,11,14) |
| InChIKey | XKRLKKHNXQCSTL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|