C15H14O2S — CID 157269849
3-ethyl-9H-thioxanthene 10,10-dioxide (PubChem CID 157269849) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-ethyl-9H-thioxanthene 10,10-dioxide.
| Compound Name | 3-ethyl-9H-thioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 157269849 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-ethyl-9H-thioxanthene 10,10-dioxide |
| SMILES | CCc1ccc2c(c1)S(=O)(=O)c1ccccc1C2 |
| InChI | InChI=1S/C15H14O2S/c1-2-11-7-8-13-10-12-5-3-4-6-14(12)18(16,17)15(13)9-11/h3-9H,2,10H2,1H3 |
| InChIKey | FQDZVMPFVBICBE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |