methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate

C12H13BrN2O3 — CID 175389736

IUPACmethyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate
SMILESCOC(=O)N1C(=O)C(C)(C)Nc2cc(Br)ccc21
InChIInChI=1S/C12H13BrN2O3/c1-12(2)10(16)15(11(17)18-3)9-5-4-7(13)6-8(9)14-12/h4-6,14H,1-3H3
InChIKeyUPIUKLFOYZDYLA-UHFFFAOYSA-N
MW313.15 g/mol
LogP2.75
Rot. Bonds

About methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate

methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate (PubChem CID 175389736) has the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. Its IUPAC name is methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate.

Molecular Properties

Compound Namemethyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate
PubChem CID175389736
Molecular FormulaC12H13BrN2O3
Molecular Weight313.15 g/mol
Exact Mass312.01
IUPAC Namemethyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate
SMILESCOC(=O)N1C(=O)C(C)(C)Nc2cc(Br)ccc21
InChIInChI=1S/C12H13BrN2O3/c1-12(2)10(16)15(11(17)18-3)9-5-4-7(13)6-8(9)14-12/h4-6,14H,1-3H3
InChIKeyUPIUKLFOYZDYLA-UHFFFAOYSA-N
XLogP2.75
TPSA58.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.15
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate?
The IUPAC name of methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate (CID 175389736) is methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate.
What is the SMILES notation for methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate?
The canonical SMILES for methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate is COC(=O)N1C(=O)C(C)(C)Nc2cc(Br)ccc21.
What is the InChIKey of methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate?
The InChIKey is UPIUKLFOYZDYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O3/c1-12(2)10(16)15(11(17)18-3)9-5-4-7(13)6-8(9)14-12/h4-6,14H,1-3H3.
What are the key properties of methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate?
methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate has a molecular weight of 313.15 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-3,3-dimethyl-2-oxo-4H-quinoxaline-1-carboxylate is sourced from PubChem (CID 175389736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).