C12H16N2O2 — CID 115096207
7-(hydroxymethyl)-1,3,3-trimethyl-4H-quinoxalin-2-one (PubChem CID 115096207) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 7-(hydroxymethyl)-1,3,3-trimethyl-4H-quinoxalin-2-one.
| Compound Name | 7-(hydroxymethyl)-1,3,3-trimethyl-4H-quinoxalin-2-one |
|---|---|
| PubChem CID | 115096207 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 7-(hydroxymethyl)-1,3,3-trimethyl-4H-quinoxalin-2-one |
| SMILES | CN1C(=O)C(C)(C)Nc2ccc(CO)cc21 |
| InChI | InChI=1S/C12H16N2O2/c1-12(2)11(16)14(3)10-6-8(7-15)4-5-9(10)13-12/h4-6,13,15H,7H2,1-3H3 |
| InChIKey | RHOVRONTFPUSPD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |