C11H16N2O — CID 115096233
(2,2-dimethyl-3,4-dihydro-1H-quinoxalin-6-yl)methanol (PubChem CID 115096233) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (2,2-dimethyl-3,4-dihydro-1H-quinoxalin-6-yl)methanol.
| Compound Name | (2,2-dimethyl-3,4-dihydro-1H-quinoxalin-6-yl)methanol |
|---|---|
| PubChem CID | 115096233 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (2,2-dimethyl-3,4-dihydro-1H-quinoxalin-6-yl)methanol |
| SMILES | CC1(C)CNc2cc(CO)ccc2N1 |
| InChI | InChI=1S/C11H16N2O/c1-11(2)7-12-10-5-8(6-14)3-4-9(10)13-11/h3-5,12-14H,6-7H2,1-2H3 |
| InChIKey | IJJRHHRTUIGTPI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |