C10H14N2O — CID 115096326
(3-methyl-1,2,3,4-tetrahydroquinoxalin-6-yl)methanol (PubChem CID 115096326) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (3-methyl-1,2,3,4-tetrahydroquinoxalin-6-yl)methanol.
| Compound Name | (3-methyl-1,2,3,4-tetrahydroquinoxalin-6-yl)methanol |
|---|---|
| PubChem CID | 115096326 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (3-methyl-1,2,3,4-tetrahydroquinoxalin-6-yl)methanol |
| SMILES | CC1CNc2ccc(CO)cc2N1 |
| InChI | InChI=1S/C10H14N2O/c1-7-5-11-9-3-2-8(6-13)4-10(9)12-7/h2-4,7,11-13H,5-6H2,1H3 |
| InChIKey | AHVQFRHEQMSSOY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |