C9H13N3 — CID 115096329
3-methyl-1,2,3,4-tetrahydroquinoxalin-6-amine (PubChem CID 115096329) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-methyl-1,2,3,4-tetrahydroquinoxalin-6-amine.
| Compound Name | 3-methyl-1,2,3,4-tetrahydroquinoxalin-6-amine |
|---|---|
| PubChem CID | 115096329 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-methyl-1,2,3,4-tetrahydroquinoxalin-6-amine |
| SMILES | CC1CNc2ccc(N)cc2N1 |
| InChI | InChI=1S/C9H13N3/c1-6-5-11-8-3-2-7(10)4-9(8)12-6/h2-4,6,11-12H,5,10H2,1H3 |
| InChIKey | ULTZHBFFPLCHJU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|