C20H15ClF3N3O — CID 11509685
2-chloro-4-[2-[2,5-dimethyl-1-[3-methyl-4-(trifluoromethoxy)phenyl]imidazol-4-yl]ethynyl]pyridine (PubChem CID 11509685) has the molecular formula C20H15ClF3N3O and a molecular weight of 405.81 g/mol. Its IUPAC name is 2-chloro-4-[2-[2,5-dimethyl-1-[3-methyl-4-(trifluoromethoxy)phenyl]imidazol-4-yl]ethynyl]pyridine.
| Compound Name | 2-chloro-4-[2-[2,5-dimethyl-1-[3-methyl-4-(trifluoromethoxy)phenyl]imidazol-4-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 11509685 |
| Molecular Formula | C20H15ClF3N3O |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-chloro-4-[2-[2,5-dimethyl-1-[3-methyl-4-(trifluoromethoxy)phenyl]imidazol-4-yl]ethynyl]pyridine |
| SMILES | Cc1cc(-n2c(C)nc(C#Cc3ccnc(Cl)c3)c2C)ccc1OC(F)(F)F |
| InChI | InChI=1S/C20H15ClF3N3O/c1-12-10-16(5-7-18(12)28-20(22,23)24)27-13(2)17(26-14(27)3)6-4-15-8-9-25-19(21)11-15/h5,7-11H,1-3H3 |
| InChIKey | STQXAFZOJOJKLY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|