C15H13F3N2O — CID 141320557
4-ethynyl-2,5-dimethyl-1-[3-methyl-4-(trifluoromethoxy)phenyl]imidazole (PubChem CID 141320557) has the molecular formula C15H13F3N2O and a molecular weight of 294.28 g/mol. Its IUPAC name is 4-ethynyl-2,5-dimethyl-1-[3-methyl-4-(trifluoromethoxy)phenyl]imidazole.
| Compound Name | 4-ethynyl-2,5-dimethyl-1-[3-methyl-4-(trifluoromethoxy)phenyl]imidazole |
|---|---|
| PubChem CID | 141320557 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-ethynyl-2,5-dimethyl-1-[3-methyl-4-(trifluoromethoxy)phenyl]imidazole |
| SMILES | C#Cc1nc(C)n(-c2ccc(OC(F)(F)F)c(C)c2)c1C |
| InChI | InChI=1S/C15H13F3N2O/c1-5-13-10(3)20(11(4)19-13)12-6-7-14(9(2)8-12)21-15(16,17)18/h1,6-8H,2-4H3 |
| InChIKey | QACUVRVFUKDVOG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|