C21H18ClF3N4O — CID 171806361
1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynyl-6-(4-methylpiperazin-1-yl)benzimidazole (PubChem CID 171806361) has the molecular formula C21H18ClF3N4O and a molecular weight of 434.85 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynyl-6-(4-methylpiperazin-1-yl)benzimidazole.
| Compound Name | 1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynyl-6-(4-methylpiperazin-1-yl)benzimidazole |
|---|---|
| PubChem CID | 171806361 |
| Molecular Formula | C21H18ClF3N4O |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynyl-6-(4-methylpiperazin-1-yl)benzimidazole |
| SMILES | C#Cc1nc2ccc(N3CCN(C)CC3)cc2n1-c1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C21H18ClF3N4O/c1-3-20-26-17-6-4-14(28-10-8-27(2)9-11-28)13-18(17)29(20)15-5-7-19(16(22)12-15)30-21(23,24)25/h1,4-7,12-13H,8-11H2,2H3 |
| InChIKey | ZLAZQBBGRFTINA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|