C21H19F3N4O — CID 171806486
2-ethynyl-5-(4-methylpiperazin-1-yl)-1-[4-(trifluoromethoxy)phenyl]benzimidazole (PubChem CID 171806486) has the molecular formula C21H19F3N4O and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-ethynyl-5-(4-methylpiperazin-1-yl)-1-[4-(trifluoromethoxy)phenyl]benzimidazole.
| Compound Name | 2-ethynyl-5-(4-methylpiperazin-1-yl)-1-[4-(trifluoromethoxy)phenyl]benzimidazole |
|---|---|
| PubChem CID | 171806486 |
| Molecular Formula | C21H19F3N4O |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-ethynyl-5-(4-methylpiperazin-1-yl)-1-[4-(trifluoromethoxy)phenyl]benzimidazole |
| SMILES | C#Cc1nc2cc(N3CCN(C)CC3)ccc2n1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N4O/c1-3-20-25-18-14-16(27-12-10-26(2)11-13-27)6-9-19(18)28(20)15-4-7-17(8-5-15)29-21(22,23)24/h1,4-9,14H,10-13H2,2H3 |
| InChIKey | UOQVOLMZHJLOPA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|