C20H17ClF3N5O — CID 171806459
3-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynyl-5-(4-methylpiperazin-1-yl)imidazo[4,5-b]pyridine (PubChem CID 171806459) has the molecular formula C20H17ClF3N5O and a molecular weight of 435.84 g/mol. Its IUPAC name is 3-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynyl-5-(4-methylpiperazin-1-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynyl-5-(4-methylpiperazin-1-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 171806459 |
| Molecular Formula | C20H17ClF3N5O |
| Molecular Weight | 435.84 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynyl-5-(4-methylpiperazin-1-yl)imidazo[4,5-b]pyridine |
| SMILES | C#Cc1nc2ccc(N3CCN(C)CC3)nc2n1-c1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H17ClF3N5O/c1-3-17-25-15-5-7-18(28-10-8-27(2)9-11-28)26-19(15)29(17)13-4-6-16(14(21)12-13)30-20(22,23)24/h1,4-7,12H,8-11H2,2H3 |
| InChIKey | QKXAJNRYIDMEBO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|