C22H17ClF3N3O — CID 171806427
6-(2-azabicyclo[2.2.1]heptan-2-yl)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynylbenzimidazole (PubChem CID 171806427) has the molecular formula C22H17ClF3N3O and a molecular weight of 431.85 g/mol. Its IUPAC name is 6-(2-azabicyclo[2.2.1]heptan-2-yl)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynylbenzimidazole.
| Compound Name | 6-(2-azabicyclo[2.2.1]heptan-2-yl)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynylbenzimidazole |
|---|---|
| PubChem CID | 171806427 |
| Molecular Formula | C22H17ClF3N3O |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 6-(2-azabicyclo[2.2.1]heptan-2-yl)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-ethynylbenzimidazole |
| SMILES | C#Cc1nc2ccc(N3CC4CCC3C4)cc2n1-c1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C22H17ClF3N3O/c1-2-21-27-18-7-5-15(28-12-13-3-4-14(28)9-13)11-19(18)29(21)16-6-8-20(17(23)10-16)30-22(24,25)26/h1,5-8,10-11,13-14H,3-4,9,12H2 |
| InChIKey | COEOPBFCHZBRMW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|