C17H24Cl3F3N2O — CID 71745192
(4aS,8aS)-4-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride (PubChem CID 71745192) has the molecular formula C17H24Cl3F3N2O and a molecular weight of 435.75 g/mol. Its IUPAC name is (4aS,8aS)-4-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride.
| Compound Name | (4aS,8aS)-4-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride |
|---|---|
| PubChem CID | 71745192 |
| Molecular Formula | C17H24Cl3F3N2O |
| Molecular Weight | 435.75 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (4aS,8aS)-4-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride |
| SMILES | CC1(C)CN(c2ccc(OC(F)(F)F)c(Cl)c2)[C@H]2CCCC[C@@H]2N1.Cl.Cl |
| InChI | InChI=1S/C17H22ClF3N2O.2ClH/c1-16(2)10-23(14-6-4-3-5-13(14)22-16)11-7-8-15(12(18)9-11)24-17(19,20)21;;/h7-9,13-14,22H,3-6,10H2,1-2H3;2*1H/t13-,14-;;/m0../s1 |
| InChIKey | VGQREEHLUWLMHR-AXEKQOJOSA-N |
| XLogP | 5.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|