C17H24ClFN2O — CID 71722104
(4aS,8aS)-4-(3-chloro-5-fluoro-4-methoxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 71722104) has the molecular formula C17H24ClFN2O and a molecular weight of 326.84 g/mol. Its IUPAC name is (4aS,8aS)-4-(3-chloro-5-fluoro-4-methoxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | (4aS,8aS)-4-(3-chloro-5-fluoro-4-methoxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 71722104 |
| Molecular Formula | C17H24ClFN2O |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (4aS,8aS)-4-(3-chloro-5-fluoro-4-methoxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | COc1c(F)cc(N2CC(C)(C)N[C@H]3CCCC[C@@H]32)cc1Cl |
| InChI | InChI=1S/C17H24ClFN2O/c1-17(2)10-21(15-7-5-4-6-14(15)20-17)11-8-12(18)16(22-3)13(19)9-11/h8-9,14-15,20H,4-7,10H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | QWFBXMSLPJDDEA-GJZGRUSLSA-N |
| XLogP | 3.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|