C17H23F3N2O — CID 118474875
(8aS)-4-[4-(difluoromethoxy)-3-fluorophenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 118474875) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is (8aS)-4-[4-(difluoromethoxy)-3-fluorophenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | (8aS)-4-[4-(difluoromethoxy)-3-fluorophenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 118474875 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (8aS)-4-[4-(difluoromethoxy)-3-fluorophenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | CC1(C)CN(c2ccc(OC(F)F)c(F)c2)C2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C17H23F3N2O/c1-17(2)10-22(14-6-4-3-5-13(14)21-17)11-7-8-15(12(18)9-11)23-16(19)20/h7-9,13-14,16,21H,3-6,10H2,1-2H3/t13-,14?/m0/s1 |
| InChIKey | DLQCLPGGVKEEJE-LSLKUGRBSA-N |
| XLogP | 3.93 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|