C21H26F2N2O — CID 71745378
(4aR,8aR)-4-[7-(difluoromethoxy)naphthalen-2-yl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 71745378) has the molecular formula C21H26F2N2O and a molecular weight of 360.45 g/mol. Its IUPAC name is (4aR,8aR)-4-[7-(difluoromethoxy)naphthalen-2-yl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | (4aR,8aR)-4-[7-(difluoromethoxy)naphthalen-2-yl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 71745378 |
| Molecular Formula | C21H26F2N2O |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (4aR,8aR)-4-[7-(difluoromethoxy)naphthalen-2-yl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | CC1(C)CN(c2ccc3ccc(OC(F)F)cc3c2)[C@@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C21H26F2N2O/c1-21(2)13-25(19-6-4-3-5-18(19)24-21)16-9-7-14-8-10-17(26-20(22)23)12-15(14)11-16/h7-12,18-20,24H,3-6,13H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | SLRICNFFHRZOMY-RTBURBONSA-N |
| XLogP | 4.94 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |