C19H28N2O — CID 71747728
(4aS,8aS)-4-(4-cyclopropyloxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 71747728) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (4aS,8aS)-4-(4-cyclopropyloxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | (4aS,8aS)-4-(4-cyclopropyloxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 71747728 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (4aS,8aS)-4-(4-cyclopropyloxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | CC1(C)CN(c2ccc(OC3CC3)cc2)[C@H]2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C19H28N2O/c1-19(2)13-21(18-6-4-3-5-17(18)20-19)14-7-9-15(10-8-14)22-16-11-12-16/h7-10,16-18,20H,3-6,11-13H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | ZVXHKMRNFKKVIZ-ROUUACIJSA-N |
| XLogP | 3.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|