C19H32Cl2N2O2 — CID 71747906
(4aS,8aS)-4-(4-ethoxy-3-methoxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride (PubChem CID 71747906) has the molecular formula C19H32Cl2N2O2 and a molecular weight of 391.38 g/mol. Its IUPAC name is (4aS,8aS)-4-(4-ethoxy-3-methoxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride.
| Compound Name | (4aS,8aS)-4-(4-ethoxy-3-methoxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride |
|---|---|
| PubChem CID | 71747906 |
| Molecular Formula | C19H32Cl2N2O2 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (4aS,8aS)-4-(4-ethoxy-3-methoxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride |
| SMILES | CCOc1ccc(N2CC(C)(C)N[C@H]3CCCC[C@@H]32)cc1OC.Cl.Cl |
| InChI | InChI=1S/C19H30N2O2.2ClH/c1-5-23-17-11-10-14(12-18(17)22-4)21-13-19(2,3)20-15-8-6-7-9-16(15)21;;/h10-12,15-16,20H,5-9,13H2,1-4H3;2*1H/t15-,16-;;/m0../s1 |
| InChIKey | MAOPGZDINXSKHA-SXBSVMRRSA-N |
| XLogP | 4.44 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|