C27H45ClF2N2O2Si — CID 172541642
[2-[4-[(4aS,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-chlorophenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane (PubChem CID 172541642) has the molecular formula C27H45ClF2N2O2Si and a molecular weight of 531.20 g/mol. Its IUPAC name is [2-[4-[(4aS,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-chlorophenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane.
| Compound Name | [2-[4-[(4aS,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-chlorophenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 172541642 |
| Molecular Formula | C27H45ClF2N2O2Si |
| Molecular Weight | 531.20 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | [2-[4-[(4aS,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-chlorophenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCC(F)(F)Oc1ccc(N2CC(C)(C)N[C@H]3CCCC[C@@H]32)cc1Cl)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H45ClF2N2O2Si/c1-18(2)35(19(3)4,20(5)6)33-17-27(29,30)34-25-14-13-21(15-22(25)28)32-16-26(7,8)31-23-11-9-10-12-24(23)32/h13-15,18-20,23-24,31H,9-12,16-17H2,1-8H3/t23-,24-/m0/s1 |
| InChIKey | FHOJOSIEMUTWQJ-ZEQRLZLVSA-N |
| XLogP | 8.00 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.20 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|