C16H22ClIN2 — CID 118474856
(4aR,8aS)-4-(3-chloro-4-iodophenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 118474856) has the molecular formula C16H22ClIN2 and a molecular weight of 404.72 g/mol. Its IUPAC name is (4aR,8aS)-4-(3-chloro-4-iodophenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | (4aR,8aS)-4-(3-chloro-4-iodophenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 118474856 |
| Molecular Formula | C16H22ClIN2 |
| Molecular Weight | 404.72 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | (4aR,8aS)-4-(3-chloro-4-iodophenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | CC1(C)CN(c2ccc(I)c(Cl)c2)[C@@H]2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C16H22ClIN2/c1-16(2)10-20(11-7-8-13(18)12(17)9-11)15-6-4-3-5-14(15)19-16/h7-9,14-15,19H,3-6,10H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | IOGAPXQIDGVBAV-LSDHHAIUSA-N |
| XLogP | 4.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.72 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|