C19H27ClN2O5 — CID 71745750
[4-[(4aR,8aR)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-chlorophenyl]methanol;oxalic acid (PubChem CID 71745750) has the molecular formula C19H27ClN2O5 and a molecular weight of 398.89 g/mol. Its IUPAC name is [4-[(4aR,8aR)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-chlorophenyl]methanol;oxalic acid.
| Compound Name | [4-[(4aR,8aR)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-chlorophenyl]methanol;oxalic acid |
|---|---|
| PubChem CID | 71745750 |
| Molecular Formula | C19H27ClN2O5 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [4-[(4aR,8aR)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-chlorophenyl]methanol;oxalic acid |
| SMILES | CC1(C)CN(c2ccc(CO)c(Cl)c2)[C@@H]2CCCC[C@H]2N1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H25ClN2O.C2H2O4/c1-17(2)11-20(16-6-4-3-5-15(16)19-17)13-8-7-12(10-21)14(18)9-13;3-1(4)2(5)6/h7-9,15-16,19,21H,3-6,10-11H2,1-2H3;(H,3,4)(H,5,6)/t15-,16-;/m1./s1 |
| InChIKey | MLTBNGDHULKRBW-QNBGGDODSA-N |
| XLogP | 2.49 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|