C18H25F3N2 — CID 71745576
(4aR,8aR)-2,2-dimethyl-4-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 71745576) has the molecular formula C18H25F3N2 and a molecular weight of 326.41 g/mol. Its IUPAC name is (4aR,8aR)-2,2-dimethyl-4-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | (4aR,8aR)-2,2-dimethyl-4-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 71745576 |
| Molecular Formula | C18H25F3N2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (4aR,8aR)-2,2-dimethyl-4-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | CC1(C)CN(c2ccc(CC(F)(F)F)cc2)[C@@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C18H25F3N2/c1-17(2)12-23(16-6-4-3-5-15(16)22-17)14-9-7-13(8-10-14)11-18(19,20)21/h7-10,15-16,22H,3-6,11-12H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | MAFVBQZKYWMRDU-HZPDHXFCSA-N |
| XLogP | 4.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|