C17H25Cl2F3N2 — CID 71745384
(4aR,8aR)-4-[4-(difluoromethyl)-3-fluorophenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride (PubChem CID 71745384) has the molecular formula C17H25Cl2F3N2 and a molecular weight of 385.30 g/mol. Its IUPAC name is (4aR,8aR)-4-[4-(difluoromethyl)-3-fluorophenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride.
| Compound Name | (4aR,8aR)-4-[4-(difluoromethyl)-3-fluorophenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride |
|---|---|
| PubChem CID | 71745384 |
| Molecular Formula | C17H25Cl2F3N2 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (4aR,8aR)-4-[4-(difluoromethyl)-3-fluorophenyl]-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride |
| SMILES | CC1(C)CN(c2ccc(C(F)F)c(F)c2)[C@@H]2CCCC[C@H]2N1.Cl.Cl |
| InChI | InChI=1S/C17H23F3N2.2ClH/c1-17(2)10-22(15-6-4-3-5-14(15)21-17)11-7-8-12(16(19)20)13(18)9-11;;/h7-9,14-16,21H,3-6,10H2,1-2H3;2*1H/t14-,15-;;/m1../s1 |
| InChIKey | YRAGZUXTYNPCQP-FXUMYAARSA-N |
| XLogP | 5.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |