C19H29Cl3N2O — CID 71747356
(4aR,8aS)-4-(3-chloro-4-cyclopropyloxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride (PubChem CID 71747356) has the molecular formula C19H29Cl3N2O and a molecular weight of 407.81 g/mol. Its IUPAC name is (4aR,8aS)-4-(3-chloro-4-cyclopropyloxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride.
| Compound Name | (4aR,8aS)-4-(3-chloro-4-cyclopropyloxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride |
|---|---|
| PubChem CID | 71747356 |
| Molecular Formula | C19H29Cl3N2O |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (4aR,8aS)-4-(3-chloro-4-cyclopropyloxyphenyl)-2,2-dimethyl-1,3,4a,5,6,7,8,8a-octahydroquinoxaline;dihydrochloride |
| SMILES | CC1(C)CN(c2ccc(OC3CC3)c(Cl)c2)[C@@H]2CCCC[C@@H]2N1.Cl.Cl |
| InChI | InChI=1S/C19H27ClN2O.2ClH/c1-19(2)12-22(17-6-4-3-5-16(17)21-19)13-7-10-18(15(20)11-13)23-14-8-9-14;;/h7,10-11,14,16-17,21H,3-6,8-9,12H2,1-2H3;2*1H/t16-,17+;;/m0../s1 |
| InChIKey | REQYLPYDOZOSBK-UXHRTOHASA-N |
| XLogP | 5.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|