C18H27Cl2F3N2O — CID 157157902
(4aS,8aS)-1-[4-(difluoromethoxy)-3-fluorophenyl]-3,3-dimethyl-4,5,6,7,8,8a-hexahydro-2H-quinolin-4a-amine;dihydrochloride (PubChem CID 157157902) has the molecular formula C18H27Cl2F3N2O and a molecular weight of 415.33 g/mol. Its IUPAC name is (4aS,8aS)-1-[4-(difluoromethoxy)-3-fluorophenyl]-3,3-dimethyl-4,5,6,7,8,8a-hexahydro-2H-quinolin-4a-amine;dihydrochloride.
| Compound Name | (4aS,8aS)-1-[4-(difluoromethoxy)-3-fluorophenyl]-3,3-dimethyl-4,5,6,7,8,8a-hexahydro-2H-quinolin-4a-amine;dihydrochloride |
|---|---|
| PubChem CID | 157157902 |
| Molecular Formula | C18H27Cl2F3N2O |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (4aS,8aS)-1-[4-(difluoromethoxy)-3-fluorophenyl]-3,3-dimethyl-4,5,6,7,8,8a-hexahydro-2H-quinolin-4a-amine;dihydrochloride |
| SMILES | CC1(C)CN(c2ccc(OC(F)F)c(F)c2)[C@H]2CCCC[C@]2(N)C1.Cl.Cl |
| InChI | InChI=1S/C18H25F3N2O.2ClH/c1-17(2)10-18(22)8-4-3-5-15(18)23(11-17)12-6-7-14(13(19)9-12)24-16(20)21;;/h6-7,9,15-16H,3-5,8,10-11,22H2,1-2H3;2*1H/t15-,18-;;/m0../s1 |
| InChIKey | AMGFAJSYODTZKK-WQPBPYDNSA-N |
| XLogP | 5.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|