C12H11F3NO5S- — CID 150118392
[1-[4-(difluoromethoxy)-3-fluorophenyl]-2-oxopyrrolidin-3-yl]methanesulfonate (PubChem CID 150118392) has the molecular formula C12H11F3NO5S- and a molecular weight of 338.28 g/mol. Its IUPAC name is [1-[4-(difluoromethoxy)-3-fluorophenyl]-2-oxopyrrolidin-3-yl]methanesulfonate.
| Compound Name | [1-[4-(difluoromethoxy)-3-fluorophenyl]-2-oxopyrrolidin-3-yl]methanesulfonate |
|---|---|
| PubChem CID | 150118392 |
| Molecular Formula | C12H11F3NO5S- |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [1-[4-(difluoromethoxy)-3-fluorophenyl]-2-oxopyrrolidin-3-yl]methanesulfonate |
| SMILES | O=C1C(CS(=O)(=O)[O-])CCN1c1ccc(OC(F)F)c(F)c1 |
| InChI | InChI=1S/C12H12F3NO5S/c13-9-5-8(1-2-10(9)21-12(14)15)16-4-3-7(11(16)17)6-22(18,19)20/h1-2,5,7,12H,3-4,6H2,(H,18,19,20)/p-1 |
| InChIKey | DYSQJJBPMBRFIA-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|