About 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane]
7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane] (PubChem CID 115097804) has the molecular formula C15H21FN2
and a molecular weight of 248.34 g/mol. Its IUPAC name is 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane].
Molecular Properties
| Compound Name | 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane] |
| PubChem CID | 115097804 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane] |
| SMILES | CC(C)N1c2ccc(F)cc2NCC12CCCC2 |
| InChI | InChI=1S/C15H21FN2/c1-11(2)18-14-6-5-12(16)9-13(14)17-10-15(18)7-3-4-8-15/h5-6,9,11,17H,3-4,7-8,10H2,1-2H3 |
| InChIKey | UVHKMFVTHYQDBM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane]?
The IUPAC name of 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane] (CID 115097804) is 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane].
What is the SMILES notation for 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane]?
The canonical SMILES for 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane] is CC(C)N1c2ccc(F)cc2NCC12CCCC2.
What is the InChIKey of 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane]?
The InChIKey is UVHKMFVTHYQDBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN2/c1-11(2)18-14-6-5-12(16)9-13(14)17-10-15(18)7-3-4-8-15/h5-6,9,11,17H,3-4,7-8,10H2,1-2H3.
What are the key properties of 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane]?
7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane] has a molecular weight of 248.34 g/mol, XLogP of 3.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-propan-2-ylspiro[1,2-dihydroquinoxaline-3,1'-cyclopentane] is sourced from PubChem (CID 115097804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).